RefMet Compound Details
RefMet ID | RM0136916 | |
---|---|---|
MW structure | 52181 (View MW Metabolite Database details) | |
RefMet name | 3-Hydroxybutanoyl-CoA | |
Alternative name | CoA 4:0;3OH | |
SMILES | CC(CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 4:0;O | View other entries in RefMet with this sum composition |
Exact mass | 853.151999 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxybutanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01975 | (S)-3-Hydroxybutanoyl-CoA + NAD+ <=> Acetoacetyl-CoA + NADH + H+ | (S)-3-Hydroxybutanoyl-CoA:NAD+ oxidoreductase |
R01976 | (S)-3-Hydroxybutanoyl-CoA + NADP+ <=> Acetoacetyl-CoA + NADPH + H+ | (S)-3-Hydroxybutanoyl-CoA:NADP+ oxidoreductase |
R03026 | (S)-3-Hydroxybutanoyl-CoA <=> Crotonoyl-CoA + H2O | (S)-3-hydroxybutanoyl-CoA hydro-lyase |
Table of KEGG human pathways containing 3-Hydroxybutanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00071 | Fatty acid degradation | 2 |
hsa00310 | Lysine degradation | 2 |
hsa00380 | Tryptophan metabolism | 2 |
hsa00650 | Butanoate metabolism | 2 |
hsa01212 | Fatty acid metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |