RefMet Compound Details
MW structure | 51679 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3-Hydroxydecanoyl-CoA | |
Alternative name | CoA 10:0;3OH | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(3S)-3-hydroxydecanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCCCC[C@@H](CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 10:0;O | View other entries in RefMet with this sum composition |
Exact mass | 937.245899 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxydecanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04743 | (S)-Hydroxydecanoyl-CoA + NAD+ <=> 3-Oxodecanoyl-CoA + NADH + H+ | (S)-hydroxydecanoyl-CoA:NAD+ oxidoreductase |
R04744 | (S)-Hydroxydecanoyl-CoA <=> trans-Dec-2-enoyl-CoA + H2O | (S)-Hydroxydecanoyl-CoA hydro-lyase |
Table of KEGG human pathways containing 3-Hydroxydecanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |
hsa01212 | Fatty acid metabolism | 2 |