RefMet Compound Details
RefMet ID | RM0152812 | |
---|---|---|
MW structure | 51653 (View MW Metabolite Database details) | |
RefMet name | 3-Hydroxyhexanoyl-CoA | |
Alternative name | CoA 6:0;3OH | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(3S)-3-hydroxyhexanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCC[C@@H](CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:0;O | View other entries in RefMet with this sum composition |
Exact mass | 881.183299 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxyhexanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04748 | (S)-Hydroxyhexanoyl-CoA + NAD+ <=> 3-Oxohexanoyl-CoA + NADH + H+ | (S)-hydroxyhexanoyl-CoA:NAD+ oxidoreductase |
R04749 | (S)-Hydroxyhexanoyl-CoA <=> trans-Hex-2-enoyl-CoA + H2O | (S)-Hydroxyhexanoyl-CoA hydro-lyase |
Table of KEGG human pathways containing 3-Hydroxyhexanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |
hsa01212 | Fatty acid metabolism | 2 |