RefMet Compound Details
RefMet ID | RM0160239 | |
---|---|---|
MW structure | 51645 (View MW Metabolite Database details) | |
RefMet name | 3-Hydroxyisobutyryl-CoA | |
Alternative name | CoA 3:0;2Me,3OH | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(2S)-3-hydroxy-2-methylpropanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | C[C@@H](CO)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 4:0;O | View other entries in RefMet with this sum composition |
Exact mass | 853.151999 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxyisobutyryl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04224 | 2-Methylprop-2-enoyl-CoA + H2O <=> (S)-3-Hydroxyisobutyryl-CoA | (S)-3-Hydroxyisobutyryl-CoA hydro-lyase |
R05064 | (S)-3-Hydroxyisobutyryl-CoA + H2O <=> CoA + (S)-3-Hydroxyisobutyrate | (S)-3-Hydroxyisobutyryl-CoA hydrolase |
Table of KEGG human pathways containing 3-Hydroxyisobutyryl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |