RefMet Compound Details
RefMet ID | RM0139564 | |
---|---|---|
MW structure | 51448 (View MW Metabolite Database details) | |
RefMet name | 3-Hydroxypropanoyl-CoA | |
Alternative name | CoA 3:0;3OH | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-{[3-({2-[(3-hydroxypropanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCSC(=O)CCO)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 3:0;O | View other entries in RefMet with this sum composition |
Exact mass | 839.136349 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxypropanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03045 | 3-Hydroxypropionyl-CoA <=> Propenoyl-CoA + H2O | 3-Hydroxypropionyl-CoA hydro-lyase |
R03158 | 3-Hydroxypropanoate + CoA <=> 3-Hydroxypropionyl-CoA + H2O | 3-Hydroxypropanoate + CoA <=> 3-Hydroxypropionyl-CoA + H2O |
R09286 | 3-Hydroxypropionyl-CoA + Diphosphate + AMP <=> 3-Hydroxypropanoate + CoA + ATP | 3-hydroxypropionate:CoA ligase (AMP-forming) |
Table of KEGG human pathways containing 3-Hydroxypropanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00410 | beta-Alanine metabolism | 2 |
hsa00640 | Propanoate metabolism | 2 |
hsa01200 | Carbon metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |