RefMet Compound Details
MW structure | 37575 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3-Methylglutaconyl-CoA | |
Alternative name | CoA DC5:1(2E);3Me | |
Systematic name | (3E)-5-{[2-(3-{3-[({[({[5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)methyl]-2-hydroxy-3-methylbutanamido}propanamido)ethyl]sulfanyl}-3-methyl-5-oxopent-3-enoic acid | |
SMILES | C/C(=C\C(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O)/CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 893.146914 (neutral) |
Table of KEGG reactions in human pathways involving 3-Methylglutaconyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02085 | (S)-3-Hydroxy-3-methylglutaryl-CoA <=> 3-Methylglutaconyl-CoA + H2O | (S)-3-Hydroxy-3-methylglutaryl-CoA hydro-lyase (trans-3-methylglutaconyl-CoA-forming) |
R04138 | ATP + 3-Methylcrotonyl-CoA + HCO3- <=> ADP + Orthophosphate + 3-Methylglutaconyl-CoA | 3-Methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming) |
Table of KEGG human pathways containing 3-Methylglutaconyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |