RefMet Compound Details
MW structure | 51646 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3-Oxooctanoyl-CoA | |
Alternative name | CoA 8:0;3oxo | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxooctanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate} | |
SMILES | CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 8:1;O | View other entries in RefMet with this sum composition |
Exact mass | 907.198949 (neutral) |
Table of KEGG reactions in human pathways involving 3-Oxooctanoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04745 | (S)-3-Hydroxyoctanoyl-CoA + NAD+ <=> 3-Oxooctanoyl-CoA + NADH + H+ | (S)-hydroxyoctanoyl-CoA:NAD+ oxidoreductase |
R04747 | Hexanoyl-CoA + Acetyl-CoA <=> CoA + 3-Oxooctanoyl-CoA | Hexanoyl-CoA:acetyl-CoA C-acyltransferase |
Table of KEGG human pathways containing 3-Oxooctanoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00062 | Fatty acid elongation | 2 |
hsa00071 | Fatty acid degradation | 2 |
hsa01212 | Fatty acid metabolism | 2 |