RefMet Compound Details
MW structure | 34426 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 32-Hydroxylanosterol | |
Systematic name | 4,4-dimethyl-14alpha-hydroxymethyl-5alpha-cholesta-8,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CC[C@@]2(CO)C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](C(C)(C)[C@@H]1CC3)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 30:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 442.381080 (neutral) |
Table of KEGG reactions in human pathways involving 32-Hydroxylanosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R05731 | Obtusifoliol + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> 4alpha-Methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + Formate + 3 [Oxidized NADPH---hemoprotein reductase] + 4 H2O | obtusifoliol,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (14-methyl cleaving) |
Table of KEGG human pathways containing 32-Hydroxylanosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 1 |