RefMet Compound Details
RefMet ID | RM0153477 | |
---|---|---|
MW structure | 50105 (View MW Metabolite Database details) | |
RefMet name | 3E-Methylglutaconyl-CoA | |
Alternative name | CoA DC5:1(3E);3Me | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(3E)-4-carboxy-3-methylbut-3-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | C/C(=CC(=O)O)/CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 6:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 893.146914 (neutral) |
Table of KEGG reactions in human pathways involving 3E-Methylglutaconyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02085 | (S)-3-Hydroxy-3-methylglutaryl-CoA <=> 3-Methylglutaconyl-CoA + H2O | (S)-3-Hydroxy-3-methylglutaryl-CoA hydro-lyase (trans-3-methylglutaconyl-CoA-forming) |
R04138 | ATP + 3-Methylcrotonyl-CoA + HCO3- <=> ADP + Orthophosphate + 3-Methylglutaconyl-CoA | 3-Methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming) |
Table of KEGG human pathways containing 3E-Methylglutaconyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |