RefMet Compound Details
MW structure | 36828 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-al | |
Systematic name | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-al | |
SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@@H]([C@]12C)O)[C@@]1(C)CC[C@H](C[C@H]1C[C@H]3O)O)C=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O4 | View other entries in RefMet with this sum composition |
Exact mass | 434.339610 (neutral) |
Table of KEGG reactions in human pathways involving 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-al
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08759 | 3alpha,7alpha,12alpha,26-Tetrahydroxy-5beta-cholestane <=> 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestan-26-al | 3alpha,7alpha,12alpha,26-Tetrahydroxy-5beta-cholestane <=> 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestan-26-al |
R08761 | 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestan-26-al + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestanoate + H2O + 2 Oxidized adrenal ferredoxin | 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestan-26-al + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> 3alpha,7alpha,12alpha-Trihydroxy-5beta-cholestanoate + H2O + 2 Oxidized adrenal ferredoxin |
Table of KEGG human pathways containing 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-al
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 2 |