RefMet Compound Details
RefMet ID | RM0135774 | |
---|---|---|
MW structure | 35421 (View MW Metabolite Database details) | |
RefMet name | 3beta,17alpha,21-Trihydroxy-pregnenone | |
Systematic name | 3beta,17alpha,21-Trihydroxy-pregn-5-en-20-one | |
SMILES | C[C@]12CC[C@@H](CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C(=O)CO)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O4 | View other entries in RefMet with this sum composition |
Exact mass | 348.230060 (neutral) |
Table of KEGG reactions in human pathways involving 3beta,17alpha,21-Trihydroxy-pregnenone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04675 | 17alpha-Hydroxypregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha,21-Dihydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-hydroxypregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R04849 | 11-Deoxycortisol + H+ + NADH <=> 17alpha,21-Dihydroxypregnenolone + NAD+ | 11-Deoxycortisol delta5-delat4-isomerase |
R04850 | 17alpha,21-Dihydroxypregnenolone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> 11beta,17alpha,21-Trihydroxypregnenolone + 2 Oxidized ferredoxin + H2O | 17alpha,21-dihydroxypregnenolone:oxygen oxidoreductase (11-hydroxylating) |
Table of KEGG human pathways containing 3beta,17alpha,21-Trihydroxy-pregnenone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |