RefMet Compound Details
MW structure | 36457 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3beta,7alpha-Dihydroxy-5-cholestenoic acid | |
Systematic name | (6R)-6-[(2R,5S,9S,15R)-5,9-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-14-yl]-2-methylheptanoic acid | |
SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@@H](CC1=C[C@H]3O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 24:2;O4 | View other entries in RefMet with this sum composition |
Exact mass | 432.323960 (neutral) |
Table of KEGG reactions in human pathways involving 3beta,7alpha-Dihydroxy-5-cholestenoic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08728 | 3beta,7alpha-Dihydroxy-5-cholestenoate + NAD+ <=> 7alpha-Hydroxy-3-oxo-4-cholestenoate + NADH + H+ | 3beta,7alpha-dihydroxy-5-cholestenoate:NAD+ 3-oxidoreductase |
R08727 | 3beta-Hydroxy-5-cholestenoate + Oxygen + NADPH + H+ <=> 3beta,7alpha-Dihydroxy-5-cholestenoate + NADP+ + H2O | 3beta-hydroxy-5-cholestenoate,NADPH:oxygen oxidoreductase (7alpha-hydroxylating) |
Table of KEGG human pathways containing 3beta,7alpha-Dihydroxy-5-cholestenoic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 2 |