RefMet Compound Details
MW structure | 37529 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4-(2-Aminophenyl)-2,4-dioxobutanoic acid | |
Systematic name | 4-(2-aminophenyl)-2,4-dioxobutanoic acid | |
SMILES | c1ccc(c(c1)C(=O)CC(=O)C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 207.053159 (neutral) |
Table of KEGG reactions in human pathways involving 4-(2-Aminophenyl)-2,4-dioxobutanoic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01956 | L-Kynurenine + 2-Oxoglutarate <=> 4-(2-Aminophenyl)-2,4-dioxobutanoate + L-Glutamate | L-Kynurenine:2-oxoglutarate aminotransferase |
Table of KEGG human pathways containing 4-(2-Aminophenyl)-2,4-dioxobutanoic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |