RefMet Compound Details
MW structure | 1987 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4-Fumarylacetoacetic acid | |
Systematic name | 4,6-dioxo-2E-octenedioic acid | |
SMILES | C(=C\C(=O)O)/C(=O)CC(=O)CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 8:4;O4 | View other entries in RefMet with this sum composition |
Exact mass | 200.032090 (neutral) |
Table of KEGG reactions in human pathways involving 4-Fumarylacetoacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01364 | Acetoacetate + Fumarate <=> 4-Fumarylacetoacetate + H2O | 4-fumarylacetoacetate fumarylhydrolase |
R03181 | 4-Maleylacetoacetate <=> 4-Fumarylacetoacetate | 4-Maleylacetoacetate cis-trans-isomerase |
Table of KEGG human pathways containing 4-Fumarylacetoacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 2 |