RefMet Compound Details
MW structure | 53105 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4-Hydroxy-2-oxoglutaric acid | |
Systematic name | 2-hydroxy-4-oxopentanedioic acid | |
SMILES | C([C@H](C(=O)O)O)C(=O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 5:2;O4 | View other entries in RefMet with this sum composition |
Exact mass | 162.016440 (neutral) |
Table of KEGG reactions in human pathways involving 4-Hydroxy-2-oxoglutaric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00470 | 4-Hydroxy-2-oxoglutarate <=> Pyruvate + Glyoxylate | 4-hydroxy-2-oxoglutarate glyoxylate-lyase (pyruvate-forming) |
Table of KEGG human pathways containing 4-Hydroxy-2-oxoglutaric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00630 | Glyoxylate and dicarboxylate metabolism | 1 |