RefMet Compound Details
MW structure | 52872 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4-Hydroxycyclophosphamide | |
Systematic name | 2-[bis(2-chloroethyl)amino]-1,3,2-oxazaphosphinan-4-ol 2-oxide | |
SMILES | C1COP(=O)(NC1O)N(CCCl)CCCl Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 276.019734 (neutral) |
Table of KEGG reactions in human pathways involving 4-Hydroxycyclophosphamide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08275 | Cyclophosphamide + NADPH + H+ + Oxygen <=> 4-Hydroxycyclophosphamide + NADP+ + H2O | Cyclophosphamide + NADPH + H+ + Oxygen <=> 4-Hydroxycyclophosphamide + NADP+ + H2O |
R08277 | 4-Hydroxycyclophosphamide <=> 4-Ketocyclophosphamide | 4-Hydroxycyclophosphamide <=> 4-Ketocyclophosphamide |
Table of KEGG human pathways containing 4-Hydroxycyclophosphamide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 2 |