RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0020531 | |
---|---|---|
RefMet name | 4-Hydroxyphenylpyruvic acid | |
Systematic name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 180.042260 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C9H8O4 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37379 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13) | |
InChIKey | KKADPXVIOXHVKN-UHFFFAOYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | c1cc(ccc1CC(=O)C(=O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organic acids | |
Main Class | Phenylpropanoids | |
Sub Class | Cinnamic acids | |
Distribution of 4-Hydroxyphenylpyruvic acid in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 4-Hydroxyphenylpyruvic acid | |
External Links | ||
Pubchem CID | 979 | |
ChEBI ID | 15999 | |
KEGG ID | C01179 | |
HMDB ID | HMDB0000707 | |
Chemspider ID | 954 | |
MetaCyc ID | P-HYDROXY-PHENYLPYRUVATE | |
EPA CompTox | DTXCID9088508 | |
Spectral data for 4-Hydroxyphenylpyruvic acid standards | ||
BMRB ID(NMR) | View NMR spectra | |
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 4-Hydroxyphenylpyruvic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00729 | L-Tyrosine + H2O + Oxygen <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + Hydrogen peroxide | L-Tyrosine:oxygen oxidoreductase (deaminating) |
R00734 | L-Tyrosine + 2-Oxoglutarate <=> 3-(4-Hydroxyphenyl)pyruvate + L-Glutamate | L-tyrosine:2-oxoglutarate aminotransferase |
R02521 | 3-(4-Hydroxyphenyl)pyruvate + Oxygen <=> Homogentisate + CO2 | 4-Hydroxyphenylpyruvate:oxygen oxidoreductase (hydroxylating,decarboxylating) |
R03342 | 3-(4-Hydroxyphenyl)pyruvate <=> 2-Hydroxy-3-(4-hydroxyphenyl)propenoate | 3-(4-Hydroxyphenyl)pyruvate keto-enol-isomerase |
R09254 | L-Tyrosine + Pyruvate <=> 3-(4-Hydroxyphenyl)pyruvate + L-Alanine | L-tyrosine:pyruvate aminotransferase |
R09830 | L-Tyrosine + H2O + NAD+ <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + NADH + H+ | L-Tyrosine:NAD+ oxidoreductase (deaminating) |
Table of KEGG human pathways containing 4-Hydroxyphenylpyruvic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 4 |
hsa00130 | Ubiquinone and other terpenoid-quinone biosynthesis | 2 |
hsa00400 | Phenylalanine, tyrosine and tryptophan biosynthesis | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa01230 | Biosynthesis of amino acids | 1 |