RefMet Compound Details
MW structure | 67717 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4-Ketocyclophosphamide | |
Systematic name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2$l^{5}-oxazaphosphinan-4-one | |
SMILES | C1COP(=O)(NC1=O)N(CCCl)CCCl Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 274.004084 (neutral) |
Table of KEGG reactions in human pathways involving 4-Ketocyclophosphamide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08277 | 4-Hydroxycyclophosphamide <=> 4-Ketocyclophosphamide | 4-Hydroxycyclophosphamide <=> 4-Ketocyclophosphamide |
Table of KEGG human pathways containing 4-Ketocyclophosphamide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 1 |