RefMet Compound Details
RefMet ID | RM0136173 | |
---|---|---|
MW structure | 38082 (View MW Metabolite Database details) | |
RefMet name | 4a-Carbinolamine tetrahydrobiopterin | |
Systematic name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-1,4,6,7-tetrahydropteridin-4-one | |
SMILES | C[C@@H]([C@@H]([C@H]1CN=c2c(=N1)c(=O)nc(N)[nH]2)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 239.101840 (neutral) |
Table of KEGG reactions in human pathways involving 4a-Carbinolamine tetrahydrobiopterin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01793 | Dihydrobiopterin + NADH + H+ <=> Tetrahydrobiopterin + NAD+ | 5,6,7,8-tetrahydrobiopterin:NAD+ oxidoreductase |
R01794 | Dihydrobiopterin + NADPH + H+ <=> Tetrahydrobiopterin + NADP+ | 5,6,7,8-tetrahydrobiopterin:NADP+ oxidoreductase |
R04734 | 4a-Hydroxytetrahydrobiopterin <=> Dihydrobiopterin + H2O | 4a-hydroxytetrahydrobiopterin hydro-lyase |
Table of KEGG human pathways containing 4a-Carbinolamine tetrahydrobiopterin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00790 | Folate biosynthesis | 3 |
hsa01100 | Metabolic pathways | 2 |