RefMet Compound Details
MW structure | 75173 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4alpha-Carboxy-4beta-methyl-zymosterol | |
Systematic name | 4alpha-carboxy-4beta-methyl-cholesta-8,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CCC2C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H]([C@](C)([C@@H]1CC3)C(=O)O)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 29:3;O3 | View other entries in RefMet with this sum composition |
Exact mass | 442.344695 (neutral) |
Table of KEGG reactions in human pathways involving 4alpha-Carboxy-4beta-methyl-zymosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07494 | 4alpha-Methylzymosterol-4-carboxylate + NADP+ <=> 3-Keto-4-methylzymosterol + NADPH + H+ + CO2 | 4alpha-Methylzymosterol-4-carboxylate + NADP+ <=> 3-Keto-4-methylzymosterol + NADPH + H+ + CO2 |
R07509 | 14-Demethyllanosterol + 6 Ferrocytochrome b5 + 3 Oxygen + 6 H+ <=> 4alpha-Methylzymosterol-4-carboxylate + 6 Ferricytochrome b5 + 4 H2O | 14-demethyllanosterol,ferrocytochrome-b5:oxygen oxidoreductase (hydroxylating) |
Table of KEGG human pathways containing 4alpha-Carboxy-4beta-methyl-zymosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |