RefMet Compound Details
MW structure | 34490 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 4alpha-Methylzymosterol | |
Systematic name | 4alpha-methyl-5alpha-cholesta-8,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H]([C@@H](C)[C@@H]1CC3)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 398.354866 (neutral) |
Table of KEGG reactions in human pathways involving 4alpha-Methylzymosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R12403 | 4alpha-Methylzymosterol + 6 Ferrocytochrome b5 + 3 Oxygen + 6 H+ <=> 4alpha-Carboxy-5alpha-cholesta-8,24-dien-3beta-ol + 6 Ferricytochrome b5 + 4 H2O | 4alpha-methylzymosterol,ferrocytochrome-b5:oxygen oxidoreductase (hydroxylating) |
R07495 | 3-Keto-4-methylzymosterol + NADPH + H+ <=> 4alpha-Methylzymosterol + NADP+ | 4alpha-methylzymosterol:NADP+ 3-oxidoreductase |
Table of KEGG human pathways containing 4alpha-Methylzymosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |