RefMet Compound Details
MW structure | 37745 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5,10-Methenyl-THF | |
Systematic name | (2S)-2-[[4-[(6aR)-3-amino-1-oxo-5,6,6a,7-tetrahydro-2H-imidazo[1,5-f]pteridin-10-ium-8-yl]benzoyl]amino]-5-hydroxy-5-oxopentanoate | |
SMILES | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)[O-])N1C[C@H]2CNc3c(c(=O)nc(N)[nH]3)[N+]2=C1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 456.163156 (neutral) |
Table of KEGG reactions in human pathways involving 5,10-Methenyl-THF
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01218 | 5,10-Methylenetetrahydrofolate + NAD+ <=> 5,10-Methenyltetrahydrofolate + NADH | 5,10-methylenetetrahydrofolate:NAD+ oxidoreductase |
R01655 | 5,10-Methenyltetrahydrofolate + H2O <=> 10-Formyltetrahydrofolate + H+ | 5,10-Methenyltetrahydrofolate 5-hydrolase (decyclizing) |
R02301 | ATP + Folinic acid + H+ <=> ADP + Orthophosphate + 5,10-Methenyltetrahydrofolate | 5-Formyltetrahydrofolate cyclo-ligase (ADP-forming) |
R01220 | 5,10-Methylenetetrahydrofolate + NADP+ <=> 5,10-Methenyltetrahydrofolate + NADPH | 5,10-methylenetetrahydrofolate:NADP+ oxidoreductase |
R04326 | 5'-Phosphoribosylglycinamide + 5,10-Methenyltetrahydrofolate + H2O <=> 5'-Phosphoribosyl-N-formylglycinamide + Tetrahydrofolate | 5'-Phosphoribosylglycinamide + 5,10-Methenyltetrahydrofolate + H2O <=> 5'-Phosphoribosyl-N-formylglycinamide + Tetrahydrofolate |
R02300 | Folinic acid <=> 5,10-Methenyltetrahydrofolate + H2O | S-Aminomethyldihydrolipoylprotein:(6S)-tetrahydrofolate aminomethyltransferase (ammonia-forming) |
R02302 | 5-Formiminotetrahydrofolate + H+ <=> 5,10-Methenyltetrahydrofolate + Ammonia | 5-Formiminotetrahydrofolate ammonia-lyase (cyclizing) |
Table of KEGG human pathways containing 5,10-Methenyl-THF
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00670 | One carbon pool by folate | 7 |