RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0136944
RefMet name5,10-Methylene-THF
Systematic name2-({4-[(6aR)-3-amino-1-oxo-1H,2H,5H,6H,6aH,7H,8H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}formamido)pentanedioic acid
SynonymsPubChem Synonyms
Exact mass457.170983 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC20H23N7O6View other entries in RefMet with this formula
Molecular descriptors
Molfile52879 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12
-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12-,13?/m1/s1
InChIKeyQYNUQALWYRSVHF-OLZOCXBDSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESc1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N1C[C@H]2CNc3c(c(=O)[nH]c(N)n3)N2C1
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganoheterocyclic compounds
Main ClassPterins
Sub ClassTetrahydrofolic acids
Distribution of 5,10-Methylene-THF in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting 5,10-Methylene-THF
External Links
Pubchem CID135398645
ChEBI ID1989
KEGG IDC00143
HMDB IDHMDB0001533
MetaCyc IDMETHYLENE-THF
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 5,10-Methylene-THF

Rxn IDKEGG ReactionEnzyme
R00945 5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R01217 5,10-Methylenetetrahydrofolate + 2 Reduced ferredoxin + 2 H+ <=> 5-Methyltetrahydrofolate + 2 Oxidized ferredoxin5-methyltetrahydrofolate:ferredoxin oxidoreductase
R01218 5,10-Methylenetetrahydrofolate + NAD+ <=> 5,10-Methenyltetrahydrofolate + NADH5,10-methylenetetrahydrofolate:NAD+ oxidoreductase
R01220 5,10-Methylenetetrahydrofolate + NADP+ <=> 5,10-Methenyltetrahydrofolate + NADPH5,10-methylenetetrahydrofolate:NADP+ oxidoreductase
R01224 5-Methyltetrahydrofolate + NADP+ <=> 5,10-Methylenetetrahydrofolate + NADPH + H+5-methyltetrahydrofolate:NADP+ oxidoreductase
R01225 5,10-Methylenetetrahydrofolate + D-Alanine + H2O <=> Tetrahydrofolate + 2-Methylserine5,10-Methylenetetrahydrofolate:D-alanine 2-hydroxymethyltransferase
R01669 5,10-Methylenetetrahydrofolate + H2O + dCMP <=> Tetrahydrofolate + 5-Hydroxymethyldeoxycytidylate5,10-methylenetetrahydrofolate:deoxycytidylate 5-hydroxymethyltransferase
R02101 dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase
R04125 [Protein]-S8-aminomethyldihydrolipoyllysine + Tetrahydrofolate <=> Dihydrolipoylprotein + 5,10-Methylenetetrahydrofolate + Ammonia[protein]-S8-aminomethyldihydrolipoyllysine:tetrahydrofolate aminomethyltransferase (ammonia-forming)
R06613 5,10-Methylenetetrahydrofolate + dUMP + NADPH + H+ <=> Tetrahydrofolate + dTMP + NADP+5,10-methylenetetrahydrofolate,NADPH:dUMP C-methyltransferase
R07168 5-Methyltetrahydrofolate + NAD+ <=> 5,10-Methylenetetrahydrofolate + NADH + H+5-methyltetrahydrofolate:NAD+ oxidoreductase

Table of KEGG human pathways containing 5,10-Methylene-THF

Pathway IDHuman Pathway# of reactions
hsa01100 Metabolic pathways 5
hsa00670 One carbon pool by folate 5
hsa00260 Glycine, serine and threonine metabolism 2
hsa01200 Carbon metabolism 2
hsa01232 Nucleotide metabolism 1
hsa01230 Biosynthesis of amino acids 1
hsa00630 Glyoxylate and dicarboxylate metabolism 1
  logo