RefMet Compound Details

MW structure	52879 (View MW Metabolite Database details)
RefMet name	5,10-Methylene-THF
Systematic name	2-({4-[(6aR)-3-amino-1-oxo-1H,2H,5H,6H,6aH,7H,8H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}formamido)pentanedioic acid
SMILES	c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N1C[C@H]2CNc3c(c(=O)[nH]c(N)n3)N2C1   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	457.170983 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C20H23N7O6	View other entries in RefMet with this formula
InChI	InChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12 -13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12-,13?/m1/s1
InChIKey	QYNUQALWYRSVHF-OLZOCXBDSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Organoheterocyclic compounds
Main Class	Pterins
Sub Class	Tetrahydrofolic acids
Pubchem CID	135398645
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 5,10-Methylene-THF

Rxn ID	KEGG Reaction	Enzyme
R02101	dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP	5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase
R01669	5,10-Methylenetetrahydrofolate + H2O + dCMP <=> Tetrahydrofolate + 5-Hydroxymethyldeoxycytidylate	5,10-methylenetetrahydrofolate:deoxycytidylate 5-hydroxymethyltransferase
R01225	5,10-Methylenetetrahydrofolate + D-Alanine + H2O <=> Tetrahydrofolate + 2-Methylserine	5,10-Methylenetetrahydrofolate:D-alanine 2-hydroxymethyltransferase
R01224	5-Methyltetrahydrofolate + NADP+ <=> 5,10-Methylenetetrahydrofolate + NADPH + H+	5-methyltetrahydrofolate:NADP+ oxidoreductase
R01218	5,10-Methylenetetrahydrofolate + NAD+ <=> 5,10-Methenyltetrahydrofolate + NADH	5,10-methylenetetrahydrofolate:NAD+ oxidoreductase
R06613	5,10-Methylenetetrahydrofolate + dUMP + NADPH + H+ <=> Tetrahydrofolate + dTMP + NADP+	5,10-methylenetetrahydrofolate,NADPH:dUMP C-methyltransferase
R04125	[Protein]-S8-aminomethyldihydrolipoyllysine + Tetrahydrofolate <=> Dihydrolipoylprotein + 5,10-Methylenetetrahydrofolate + Ammonia	[protein]-S8-aminomethyldihydrolipoyllysine:tetrahydrofolate aminomethyltransferase (ammonia-forming)
R00945	5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine	5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R01217	5,10-Methylenetetrahydrofolate + 2 Reduced ferredoxin + 2 H+ <=> 5-Methyltetrahydrofolate + 2 Oxidized ferredoxin	5-methyltetrahydrofolate:ferredoxin oxidoreductase
R01220	5,10-Methylenetetrahydrofolate + NADP+ <=> 5,10-Methenyltetrahydrofolate + NADPH	5,10-methylenetetrahydrofolate:NADP+ oxidoreductase
R07168	5-Methyltetrahydrofolate + NAD+ <=> 5,10-Methylenetetrahydrofolate + NADH + H+	5-methyltetrahydrofolate:NAD+ oxidoreductase

Table of KEGG human pathways containing 5,10-Methylene-THF

Pathway ID	Human Pathway	# of reactions
hsa01100	Metabolic pathways	5
hsa00670	One carbon pool by folate	5
hsa00260	Glycine, serine and threonine metabolism	2
hsa01200	Carbon metabolism	2
hsa01232	Nucleotide metabolism	1
hsa01230	Biosynthesis of amino acids	1
hsa00630	Glyoxylate and dicarboxylate metabolism	1