RefMet Compound Details
MW structure | 2612 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5,6-DiHETrE | |
Systematic name | 5,6-dihydroxy-8Z,11Z,14Z-eicosatrienoic acid | |
SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(C(CCCC(=O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 338.245710 (neutral) |
Table of KEGG reactions in human pathways involving 5,6-DiHETrE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07111 | 5,6-EET + H2O <=> 5,6-DHET | 5,6-EET hydrolase |
Table of KEGG human pathways containing 5,6-DiHETrE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |