RefMet Compound Details
MW structure | 50198 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-Formimidoyl-THF | |
Systematic name | N-[4-({[(6S)-2-amino-5-formimidoyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid | |
SMILES | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC[C@H]1CNc2c(c(=O)[nH]c(N)n2)N1C=N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 472.181882 (neutral) |
Table of KEGG reactions in human pathways involving 5-Formimidoyl-THF
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02287 | 5-Formiminotetrahydrofolate + L-Glutamate <=> Tetrahydrofolate + N-Formimino-L-glutamate | 5-Formiminotetrahydrofolate:L-glutamate N-formiminotransferase |
R02302 | 5-Formiminotetrahydrofolate + H+ <=> 5,10-Methenyltetrahydrofolate + Ammonia | 5-Formiminotetrahydrofolate ammonia-lyase (cyclizing) |
Table of KEGG human pathways containing 5-Formimidoyl-THF
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00670 | One carbon pool by folate | 1 |