RefMet Compound Details
MW structure | 78551 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-Hydroxy-N-formylkynurenine | |
Systematic name | 2-amino-4-(2-formamido-5-hydroxy-phenyl)-4-oxo-butanoic acid | |
SMILES | NC(CC(=O)c1cc(O)ccc1NC=O)C(O)=O | |
Exact mass | 252.074623 (neutral) |
Table of KEGG reactions in human pathways involving 5-Hydroxy-N-formylkynurenine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02702 | 5-Hydroxy-L-tryptophan + Oxygen <=> 5-Hydroxy-N-formylkynurenine | 5-hydroxy-L-tryptophan:oxygen 2,3-dioxygenase (indole-decyclizing) |
R04911 | 5-Hydroxy-N-formylkynurenine + H2O <=> 5-Hydroxykynurenine + Formate | Aryl-formylamine amidohydrolase |
Table of KEGG human pathways containing 5-Hydroxy-N-formylkynurenine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 2 |