RefMet Compound Details
MW structure | 38455 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-Hydroxyindoleacetaldehyde | |
Systematic name | 2-(5-hydroxy-1H-indol-3-yl)acetaldehyde | |
SMILES | c1cc2c(cc1O)c(CC=O)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 175.063329 (neutral) |
Table of KEGG reactions in human pathways involving 5-Hydroxyindoleacetaldehyde
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04904 | 5-Hydroxyindoleacetaldehyde + Oxygen + H2O <=> 5-Hydroxyindoleacetate + Hydrogen peroxide | 5-hydroxyindoleacetaldehyde:oxygen oxidoreductase |
R02908 | Serotonin + H2O + Oxygen <=> 5-Hydroxyindoleacetaldehyde + Ammonia + Hydrogen peroxide | 5-Hydroxytryptamine:oxygen oxidoreductase(deaminating)(flavin-containing) |
R04903 | 5-Hydroxyindoleacetaldehyde + NAD+ + H2O <=> 5-Hydroxyindoleacetate + H+ + NADH | 5-Hydroxyindoleacetaldehyde:NAD+ oxidoreductase |
Table of KEGG human pathways containing 5-Hydroxyindoleacetaldehyde
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |