RefMet Compound Details
RefMet ID | RM0028464 | |
---|---|---|
MW structure | 38467 (View MW Metabolite Database details) | |
RefMet name | 5-Methoxyindoleacetic acid | |
Systematic name | 2-(5-methoxy-1H-indol-3-yl)acetic acid | |
SMILES | COc1ccc2c(c1)c(CC(=O)O)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 205.073894 (neutral) |
Table of KEGG reactions in human pathways involving 5-Methoxyindoleacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04905 | S-Adenosyl-L-methionine + 5-Hydroxyindoleacetate <=> S-Adenosyl-L-homocysteine + 5-Methoxyindoleacetate | S-Adenosyl-L-methionine:N-acetylserotonin O-methyltransferase |
Table of KEGG human pathways containing 5-Methoxyindoleacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |