RefMet Compound Details
MW structure | 37524 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-Methylthioribose 1-phosphate | |
Systematic name | [(3R,4S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]dihydrogenphosphate | |
SMILES | CSCC1[C@H]([C@H](C(O1)OP(=O)(O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 260.011965 (neutral) |
Table of KEGG reactions in human pathways involving 5-Methylthioribose 1-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04420 | S-Methyl-5-thio-D-ribose 1-phosphate <=> S-Methyl-5-thio-D-ribulose 1-phosphate | 5-methylthio-5-deoxy-D-ribose-1-phosphate ketol-isomerase |
R01402 | 5'-Methylthioadenosine + Orthophosphate <=> Adenine + S-Methyl-5-thio-D-ribose 1-phosphate | S-methyl-5'-thioadenosine:phosphate S-methyl-5-thio-alpha-D-ribosyl-transferase |
Table of KEGG human pathways containing 5-Methylthioribose 1-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 2 |