RefMet Compound Details
RefMet ID | RM0108994 | |
---|---|---|
MW structure | 37618 (View MW Metabolite Database details) | |
RefMet name | 5-Phosphoribosylamine | |
Systematic name | {[(2R,3S,4R,5R)-5-amino-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](N)O1)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 229.035142 (neutral) |
Table of KEGG reactions in human pathways involving 5-Phosphoribosylamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01072 | 5-Phosphoribosylamine + Diphosphate + L-Glutamate <=> L-Glutamine + 5-Phospho-alpha-D-ribose 1-diphosphate + H2O | 5-phosphoribosylamine:diphosphate phospho-alpha-D-ribosyltransferase (glutamate-amidating) |
R04144 | ATP + 5-Phosphoribosylamine + Glycine <=> ADP + Orthophosphate + 5'-Phosphoribosylglycinamide | 5-Phospho-D-ribosylamine:glycine ligase (ADP-forming) |
Table of KEGG human pathways containing 5-Phosphoribosylamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 1 |