RefMet Compound Details
RefMet ID | RM0152295 | |
---|---|---|
MW structure | 2638 (View MW Metabolite Database details) | |
RefMet name | 5S-HpETE | |
Systematic name | 5S-hydroperoxy-6E,8Z,11Z,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=CC/C=CC/C=CC=C[C@H](CCCC(=O)O)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 5S-HpETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01595 | Arachidonate + Oxygen <=> 5(S)-HPETE | Arachidonate:oxygen 5-oxidoreductase |
R03058 | 5(S)-HPETE <=> Leukotriene A4 + H2O | arachidonate:oxygen 5-oxidoreductase |
R07034 | 2 Glutathione + 5(S)-HPETE <=> Glutathione disulfide + 5(S)-HETE + H2O | Glutathione: 5-HPETE oxidoreductase |
Table of KEGG human pathways containing 5S-HpETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 3 |