RefMet Compound Details
RefMet ID | RM0135775 | |
---|---|---|
MW structure | 35425 (View MW Metabolite Database details) | |
RefMet name | 5beta-Pregnane-3,20-dione | |
Systematic name | 5beta-pregnane-3,20-dione | |
SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 316.240230 (neutral) |
Table of KEGG reactions in human pathways involving 5beta-Pregnane-3,20-dione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02215 | 5beta-Pregnane-3,20-dione + Acceptor <=> Progesterone + Reduced acceptor | 5beta-Pregnane-3,20-dione:(acceptor) delta4-oxidoreductase |
R02219 | Progesterone + NADPH + H+ <=> 5beta-Pregnane-3,20-dione + NADP+ | 3-Oxo-5beta-steroid:NADP+ delta4-oxidoreductase |
R04845 | Pregnanolone + NAD+ <=> 5beta-Pregnane-3,20-dione + NADH + H+ | 3alpha-Hydroxy-5beta-pregnane-20-one:NAD+ oxidoreductase (B-specific) |
R04846 | Pregnanolone + NADP+ <=> 5beta-Pregnane-3,20-dione + NADPH + H+ | 3alpha-Hydroxy-5beta-pregnane-20-one:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing 5beta-Pregnane-3,20-dione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |
hsa01100 | Metabolic pathways | 3 |