RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0013440 | |
---|---|---|
RefMet name | 6-Phosphonoglucono-D-lactone | |
Systematic name | {[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methoxy}phosphonic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 258.014068 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C6H11O9P | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37617 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C6H11O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-5,7-9H,1H2,(H2,11,12,13)/t2-,3-,4+,5-/m1/s1 | |
InChIKey | IJOJIVNDFQSGAB-SQOUGZDYSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)OP(=O)(O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Carbohydrates | |
Main Class | Monosaccharides | |
Sub Class | Hexose phosphates | |
Distribution of 6-Phosphonoglucono-D-lactone in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting 6-Phosphonoglucono-D-lactone | |
External Links | ||
Pubchem CID | 439452 | |
ChEBI ID | 16938 | |
KEGG ID | C01236 | |
HMDB ID | HMDB0001127 | |
Chemspider ID | 388559 | |
MetaCyc ID | D-6-P-GLUCONO-DELTA-LACTONE | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving 6-Phosphonoglucono-D-lactone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02035 | D-Glucono-1,5-lactone 6-phosphate + H2O <=> 6-Phospho-D-gluconate | 6-Phospho-D-glucono-1,5-lactone lactonohydrolase |
R02736 | beta-D-Glucose 6-phosphate + NADP+ <=> D-Glucono-1,5-lactone 6-phosphate + NADPH + H+ | beta-D-glucose-6-phosphate:NADP+ 1-oxoreductase |
R10907 | beta-D-Glucose 6-phosphate + NAD+ <=> D-Glucono-1,5-lactone 6-phosphate + NADH + H+ | beta-D-glucose-6-phosphate:NAD+ 1-oxidoreductase |
Table of KEGG human pathways containing 6-Phosphonoglucono-D-lactone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 3 |
hsa01200 | Carbon metabolism | 2 |
hsa00480 | Glutathione metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |