RefMet Compound Details
MW structure | 50734 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 7,8-Dihydroneopterin | |
Systematic name | 2-amino-6-[(1S,2R)-1,2,3-trihydroxypropyl]-7,8-dihydropteridin-4(3H)-one | |
SMILES | C1C(=Nc2c(N1)nc(N)[nH]c2=O)[C@@H]([C@@H](CO)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 255.096754 (neutral) |
Table of KEGG reactions in human pathways involving 7,8-Dihydroneopterin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04620 | 7,8-Dihydroneopterin 3'-triphosphate + 3 H2O <=> 7,8-Dihydroneopterin + 3 Orthophosphate | 7,8-dihydroneopterin-3'-triphosphate phosphohydrolase (alkaline optimum) |
Table of KEGG human pathways containing 7,8-Dihydroneopterin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00790 | Folate biosynthesis | 1 |