RefMet Compound Details
MW structure | 36830 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 7alpha,25-Dihydroxycholesterol | |
Systematic name | cholest-5-en-3beta,7alpha,25-triol | |
SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@@H](CC1=C[C@H]3O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O3 | View other entries in RefMet with this sum composition |
Exact mass | 418.344695 (neutral) |
Table of KEGG reactions in human pathways involving 7alpha,25-Dihydroxycholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07209 | 25-Hydroxycholesterol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cholest-5-ene-3beta,7alpha,25-triol + [Oxidized NADPH---hemoprotein reductase] + H2O | cholest-5-ene-3beta,25-diol,[NADPH---hemoprotein reductase]:oxygen oxidoreductase (7alpha-hydroxylating) |
R08723 | Cholest-5-ene-3beta,7alpha,25-triol + NAD+ <=> 7alpha,25-Dihydroxy-4-cholesten-3-one + NADH + H+ | cholest-5-ene-3beta,7alpha,25-triol:NAD+ 3-oxidoreductase |
Table of KEGG human pathways containing 7alpha,25-Dihydroxycholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 2 |