RefMet Compound Details
RefMet ID | RM0125889 | |
---|---|---|
MW structure | 36784 (View MW Metabolite Database details) | |
RefMet name | 7alpha-Hydroxy-5beta-cholestan-3-one | |
Systematic name | (2S,9S,15R)-9-hydroxy-2,15-dimethyl-14-(6-methylheptan-2-yl)tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-5-one | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CCC(=O)C[C@H]1C[C@H]3O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 402.349780 (neutral) |
Table of KEGG reactions in human pathways involving 7alpha-Hydroxy-5beta-cholestan-3-one
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04817 | 7alpha-Hydroxy-5beta-cholestan-3-one + NADP+ <=> 7alpha-Hydroxycholest-4-en-3-one + NADPH + H+ | 7alpha-Hydroxy-5beta-cholestan-3-one:NADP+ delta4-oxidoreductase |
R04818 | 3alpha,7alpha-Dihydroxy-5beta-cholestane + NAD+ <=> 7alpha-Hydroxy-5beta-cholestan-3-one + NADH + H+ | 3alpha,7alpha-Dihydroxy-5beta-cholestane:NAD+ oxidoreductase (B-specific) |
R04819 | 3alpha,7alpha-Dihydroxy-5beta-cholestane + NADP+ <=> 7alpha-Hydroxy-5beta-cholestan-3-one + NADPH + H+ | 3alpha,7alpha-Dihydroxy-5beta-cholestane:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing 7alpha-Hydroxy-5beta-cholestan-3-one
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 3 |
hsa01100 | Metabolic pathways | 2 |