RefMet Compound Details
RefMet ID | RM0073555 | |
---|---|---|
MW structure | 2681 (View MW Metabolite Database details) | |
RefMet name | 8S-HpETE | |
Systematic name | 8S-hydoperoxy-5Z,9E,11Z,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=CC/C=CC=C[C@H](C/C=CCCCC(=O)O)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 8S-HpETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07053 | Arachidonate + Oxygen <=> 8(S)-HPETE | Arachidonate:oxygen 8-oxidoreductase |
Table of KEGG human pathways containing 8S-HpETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |