RefMet Compound Details
MW structure | 29032 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 9-cis-Retinol | |
Systematic name | 9Z-retinol | |
SMILES | C/C(=C/C=C/C(=C/CO)/C)/C=C/C1=C(C)CCCC1(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 286.229665 (neutral) |
Table of KEGG reactions in human pathways involving 9-cis-Retinol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08383 | 9-cis-Retinol + NADP+ <=> 9-cis-Retinal + NADPH + H+ | 9-cis-Retinol + NADP+ <=> 9-cis-Retinal + NADPH + H+ |
R08382 | 9-cis-Retinol + NAD+ <=> 9-cis-Retinal + NADH + H+ | 9-cis-retinol:NAD+ oxidoreductase |
Table of KEGG human pathways containing 9-cis-Retinol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00830 | Retinol metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |