RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135012 | |
---|---|---|
RefMet name | Acetoacetyl-CoA | |
Alternative name | CoA 4:0;3oxo | |
Systematic name | Acetoacetyl-CoA | |
Synonyms | PubChem Synonyms | |
Sum Composition | CoA 4:1;O | View other entries in RefMet with this sum composition |
Exact mass | 851.136349 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C25H40N7O18P3S | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 4428 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C25H40N7O18P3S/c1-13(33)8-16(35)54-7-6-27-15(34)4-5-28-23(38)20(37)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-19(49-51(39, 40)41)18(36)24(48-14)32-12-31-17-21(26)29-11-30-22(17)32/h11-12,14,18-20,24,36-37H,4-10H2,1-3H3,(H,27,34)(H,28,38)(H,42,43)(H,44,4 5)(H2,26,29,30)(H2,39,40,41)/t14-,18-,19-,20+,24-/m1/s1 | |
InChIKey | OJFDKHTZOUZBOS-CITAKDKDSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Fatty Acyls | |
Main Class | Fatty esters | |
Sub Class | Acyl CoAs | |
Distribution of Acetoacetyl-CoA in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Acetoacetyl-CoA | |
External Links | ||
Pubchem CID | 92153 | |
LIPID MAPS | LMFA07050030 | |
ChEBI ID | 15345 | |
KEGG ID | C00332 | |
HMDB ID | HMDB0001484 | |
MetaCyc ID | ACETOACETYL-COA | |
Spectral data for Acetoacetyl-CoA standards | ||
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Acetoacetyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00238 | 2 Acetyl-CoA <=> CoA + Acetoacetyl-CoA | acetyl-CoA:acetyl-CoA C-acetyltransferase |
R00410 | Succinyl-CoA + Acetoacetate <=> Succinate + Acetoacetyl-CoA | succinyl-CoA:acetoacetate CoA-transferase |
R01357 | ATP + Acetoacetate + CoA <=> AMP + Diphosphate + Acetoacetyl-CoA | Acetoacetate:CoA ligase (AMP-forming) |
R01358 | Acetoacetyl-CoA + H2O <=> Acetoacetate + CoA | acetoacetyl-CoA hydrolase |
R01359 | Acetoacetyl-CoA + Acetate <=> Acetoacetate + Acetyl-CoA | acetoacetyl-CoA:acetate CoA-transferase |
R01975 | (S)-3-Hydroxybutanoyl-CoA + NAD+ <=> Acetoacetyl-CoA + NADH + H+ | (S)-3-Hydroxybutanoyl-CoA:NAD+ oxidoreductase |
R01976 | (S)-3-Hydroxybutanoyl-CoA + NADP+ <=> Acetoacetyl-CoA + NADPH + H+ | (S)-3-Hydroxybutanoyl-CoA:NADP+ oxidoreductase |
Table of KEGG human pathways containing Acetoacetyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00650 | Butanoate metabolism | 5 |
hsa00280 | Valine, leucine and isoleucine degradation | 4 |
hsa01100 | Metabolic pathways | 3 |
hsa00072 | Synthesis and degradation of ketone bodies | 3 |
hsa00071 | Fatty acid degradation | 2 |
hsa00310 | Lysine degradation | 2 |
hsa00380 | Tryptophan metabolism | 2 |
hsa00900 | Terpenoid backbone biosynthesis | 2 |
hsa01212 | Fatty acid metabolism | 2 |
hsa01200 | Carbon metabolism | 1 |
hsa00620 | Pyruvate metabolism | 1 |
hsa00640 | Propanoate metabolism | 1 |
hsa00630 | Glyoxylate and dicarboxylate metabolism | 1 |