RefMet Compound Details
MW structure | 39083 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Acetyl adenylate | |
Systematic name | (acetyloxy)({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy})phosphinic acid | |
SMILES | CC(=O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 389.073653 (neutral) |
Table of KEGG reactions in human pathways involving Acetyl adenylate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00316 | ATP + Acetate <=> Diphosphate + Acetyl adenylate | ATP:acetate adenylyltransferase |
R00236 | Acetyl adenylate + CoA <=> AMP + Acetyl-CoA | acetyl adenylate:CoA acetyltransferase |
Table of KEGG human pathways containing Acetyl adenylate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00620 | Pyruvate metabolism | 2 |