RefMet Compound Details
RefMet ID | RM0135870 | |
---|---|---|
MW structure | 37045 (View MW Metabolite Database details) | |
RefMet name | Adenosine | |
Systematic name | (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 267.096755 (neutral) |
Table of KEGG reactions in human pathways involving Adenosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00183 | AMP + H2O <=> Adenosine + Orthophosphate | adenosine 5'-monophosphate phosphohydrolase |
R00185 | ATP + Adenosine <=> ADP + AMP | ATP:adenosine 5'-phosphotransferase |
R01245 | Adenosine + H2O <=> Adenine + D-Ribose | Adenosine ribohydrolase |
R01560 | Adenosine + H2O <=> Inosine + Ammonia | Adenosine aminohydrolase |
R01561 | Adenosine + Orthophosphate <=> Adenine + alpha-D-Ribose 1-phosphate | adenosine:phosphate alpha-D-ribosyltransferase |
Table of KEGG human pathways containing Adenosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |