RefMet Compound Details
RefMet ID | RM0157554 | |
---|---|---|
MW structure | 37541 (View MW Metabolite Database details) | |
RefMet name | Adenosine phosphosulfate | |
Systematic name | [({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]sulfonic acid | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)OP(=O)(O)OS(=O)(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 427.019899 (neutral) |
Table of KEGG reactions in human pathways involving Adenosine phosphosulfate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00508 | 3'-Phosphoadenylyl sulfate + H2O <=> Adenylyl sulfate + Orthophosphate | 3'-phospho-5'-adenylyl sulfate 3'-phosphohydrolase |
R00509 | ATP + Adenylyl sulfate <=> ADP + 3'-Phosphoadenylyl sulfate | ATP:adenylylsulfate 3'-phosphotransferase |
R00529 | ATP + Sulfate <=> Diphosphate + Adenylyl sulfate | ATP:sulfate adenylyltransferase |
R00530 | ADP + Sulfate <=> Orthophosphate + Adenylyl sulfate | ADP:sulfate adenylyltransferase |
R00531 | Adenylyl sulfate + H2O <=> AMP + Sulfate | Adenylylsulfate sulfohydrolase |
Table of KEGG human pathways containing Adenosine phosphosulfate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00920 | Sulfur metabolism | 3 |
hsa00230 | Purine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |