RefMet Compound Details

RefMet IDRM0052834
MW structure52937 (View MW Metabolite Database details)
RefMet nameAflatoxin B1
Systematic name(6aR,9aS)-4-methoxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione
SMILESCOc1cc2c([C@@H]3C=CO[C@@H]3O2)c2c1c1CCC(=O)c1c(=O)o2   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass312.063390 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC17H12O6View other entries in RefMet with this formula
InChIInChI=1S/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3/t8-,17+/m0/s1
InChIKeyOQIQSTLJSLGHID-WNWIJWBNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassPolyketides
Main ClassFlavonoids
Sub ClassFuranocoumarins
Pubchem CID186907
ChEBI ID2504
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Aflatoxin B1

Rxn IDKEGG ReactionEnzyme
R09404 Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin Q1 + H2O + NADP+Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin Q1 + H2O + NADP+
R09405 Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin M1 + H2O + NADP+Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin M1 + H2O + NADP+
R09407 Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin B1-endo-8,9-epoxide + H2O + NADP+Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin B1-endo-8,9-epoxide + H2O + NADP+
R09408 Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin B1-exo-8,9-epoxide + H2O + NADP+Aflatoxin B1 + Oxygen + NADPH + H+ <=> Aflatoxin B1-exo-8,9-epoxide + H2O + NADP+

Table of KEGG human pathways containing Aflatoxin B1

Pathway IDHuman Pathway# of reactions
hsa00980 Metabolism of xenobiotics by cytochrome P450 4
  logo