RefMet Compound Details
RefMet ID | RM0138824 | |
---|---|---|
MW structure | 21376 (View MW Metabolite Database details) | |
RefMet name | Aflatoxin B1exo-8,9-epoxide-GSH | |
Systematic name | 2-amino-5-[[1-(carboxymethylamino)-3-[[(4R,5S)-4-hydroxy-11-methoxy-16,18-dioxo-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,9,11,13(17)-tetraen-5-yl]sulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid | |
SMILES | COc1cc2c(C3[C@H]([C@@H](OC3O2)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)O)c2c1c1CCC(=O)c1c(=O)o2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 635.142114 (neutral) |
Table of KEGG reactions in human pathways involving Aflatoxin B1exo-8,9-epoxide-GSH
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R09409 | Aflatoxin B1-exo-8,9-epoxide + Glutathione <=> Aflatoxin B1exo-8,9-epoxide-GSH | glutathione-S-transferase |
Table of KEGG human pathways containing Aflatoxin B1exo-8,9-epoxide-GSH
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00980 | Metabolism of xenobiotics by cytochrome P450 | 1 |