RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0136845 | |
---|---|---|
RefMet name | Allysine | |
Systematic name | 2-amino-6-oxohexanoic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 145.073894 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C6H11NO3 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 51090 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C6H11NO3/c7-5(6(9)10)3-1-2-4-8/h4-5H,1-3,7H2,(H,9,10)/t5-/m0/s1 | |
InChIKey | GFXYTQPNNXGICT-YFKPBYRVSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C(CC=O)C[C@@H](C(=O)O)N
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organic acids | |
Main Class | Amino acids and peptides | |
Sub Class | Amino acids | |
Distribution of Allysine in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Allysine | |
External Links | ||
Pubchem CID | 160603 | |
ChEBI ID | 17917 | |
KEGG ID | C04076 | |
HMDB ID | HMDB0001263 | |
MetaCyc ID | ALLYSINE | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Allysine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02313 | N6-(L-1,3-Dicarboxypropyl)-L-lysine + NAD+ + H2O <=> L-Glutamate + L-2-Aminoadipate 6-semialdehyde + NADH + H+ | N6-(L-1,3-Dicarboxypropyl)-L-lysine:NAD+ oxidoreductase |
R02315 | N6-(L-1,3-Dicarboxypropyl)-L-lysine + NADP+ + H2O <=> L-Glutamate + L-2-Aminoadipate 6-semialdehyde + NADPH + H+ | N6-(L-1,3-Dicarboxypropyl)-L-lysine:NADP+ oxidoreductase |
R03102 | L-2-Aminoadipate 6-semialdehyde + NAD+ + H2O <=> L-2-Aminoadipate + NADH + H+ | L-2-aminoadipate-6-semialdehyde:NAD+ 6-oxidoreductase |
R03103 | L-2-Aminoadipate 6-semialdehyde + NADP+ + H2O <=> L-2-Aminoadipate + NADPH + H+ | L-2-aminoadipate-6-semialdehyde:NADP+ 6-oxidoreductase |
R10270 | 5-Phosphooxy-L-lysine + H2O <=> L-2-Aminoadipate 6-semialdehyde + Ammonia + Orthophosphate | (5R)-5-phosphooxy-L-lysine phosphate-lyase (deaminating |
R13037 | L-2-Aminoadipate 6-semialdehyde <=> L-2-Aminoadipate | L-aminoadipate-semialdehyde dehydrogenase |
Table of KEGG human pathways containing Allysine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00310 | Lysine degradation | 4 |
hsa01100 | Metabolic pathways | 4 |