RefMet Compound Details
MW structure | 35317 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Androstenedione | |
Systematic name | androst-4-ene-3,17-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC[C@H]21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:3;O2 | View other entries in RefMet with this sum composition |
Exact mass | 286.193280 (neutral) |
Table of KEGG reactions in human pathways involving Androstenedione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01838 | Testosterone + NADP+ <=> Androstenedione + NADPH + H+ | testosterone:NADP+ 17-oxidoreductase |
R02725 | 2 Reduced adrenal ferredoxin + Androstenedione + Oxygen + 2 H+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + 2 Oxidized adrenal ferredoxin + H2O | Androstenedione,reduced-adrenal-ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R01835 | 5beta-Androstane-3,17-dione + NADP+ <=> H+ + NADPH + Androstenedione | 5beta-androstane-3,17-dione:NADP+ 4,5-oxidoreductase |
R08518 | 17alpha-Hydroxyprogesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Androstenedione + Acetate + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-hydroxyprogesterone,NADPH---hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating, acetate-releasing) |
R10242 | 5alpha-Androstane-3,17-dione + NADP+ <=> Androstenedione + NADPH + H+ | 5alpha-androstane-3,17-dione:NADP+ delta4-oxidoreductase |
R01837 | Dehydroepiandrosterone + NAD+ <=> Androstenedione + NADH + H+ | 3beta-Hydroxyandrost-5-en-17-one:NAD+ 3-oxidoreductase/delta5-delta-4 isomerase |
R01840 | Androstenedione + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19-Hydroxyandrost-4-ene-3,17-dione + [Oxidized NADPH---hemoprotein reductase] + H2O | androstenedione,NADPH---hemoprotein reductase:oxygen oxidoreductase (19-hydroxylating) |
R01836 | Testosterone + NAD+ <=> Androstenedione + NADH + H+ | testosterone:NAD+ 17-oxidoreductase |
Table of KEGG human pathways containing Androstenedione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 8 |