RefMet Compound Details
RefMet ID | RM0135838 | |
---|---|---|
MW structure | 36911 (View MW Metabolite Database details) | |
RefMet name | Androsterone 3-glucuronide | |
Systematic name | 3alpha-hydroxy-5alpha-androstan-17-one 3-D-glucuronide | |
SMILES | C[C@]12CC[C@H](C[C@@H]1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC[C@H]21)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:1;O2;GlcA | View other entries in RefMet with this sum composition |
Exact mass | 466.256670 (neutral) |
Table of KEGG reactions in human pathways involving Androsterone 3-glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02478 | Androsterone + UDP-glucuronate <=> Androsterone glucuronide + UDP | UDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific) |
Table of KEGG human pathways containing Androsterone 3-glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 1 |