RefMet Compound Details
MW structure | 37129 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Anserine | |
Systematic name | (2S)-2-(3-aminopropanamido)-3-(1-methyl-1H-imidazol-5-yl)propanoic acid | |
SMILES | Cn1cncc1C[C@@H](C(=O)O)NC(=O)CCN Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 240.122241 (neutral) |
Table of KEGG reactions in human pathways involving Anserine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02144 | S-Adenosyl-L-methionine + Carnosine <=> S-Adenosyl-L-homocysteine + beta-Alanyl-N(pi)-methyl-L-histidine | S-adenosyl-L-methionine:carnosine N-methyltransferase |
R03288 | beta-Alanyl-N(pi)-methyl-L-histidine + H2O <=> beta-Alanine + N(pi)-Methyl-L-histidine | beta-alanyl-N(pi)-methyl-L-histidine hydrolase |
R03286 | ATP + N(pi)-Methyl-L-histidine + beta-Alanine <=> ADP + Orthophosphate + beta-Alanyl-N(pi)-methyl-L-histidine | N(pi)-methyl-L-histidine:beta-alanine ligase (ADP-forming) |
Table of KEGG human pathways containing Anserine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00340 | Histidine metabolism | 2 |
hsa00410 | beta-Alanine metabolism | 2 |