RefMet Compound Details

Created with Raphaƫl 2.1.0OOH
RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0153612
RefMet nameArachidonic acid
Alternative nameFA 20:4(5Z,8Z,11Z,14Z)
Systematic name5Z,8Z,11Z,14Z-eicosatetraenoic acid
SynonymsPubChem Synonyms
Sum CompositionFA 20:4 View other entries in RefMet with this sum composition
Exact mass304.240230 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC20H32O2View other entries in RefMet with this formula
Molecular descriptors
Molfile436 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,2
2)/b7-6-,10-9-,13-12-,16-15-
InChIKeyYZXBAPSDXZZRGB-DOFZRALJSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassFatty Acyls
Main ClassFatty acids
Sub ClassUnsaturated FA
Distribution of Arachidonic acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Arachidonic acid
External Links
Pubchem CID444899
LIPID MAPSLMFA01030001
ChEBI ID15843
KEGG IDC00219
HMDB IDHMDB0001043
Chemspider ID392692
MetaCyc IDARACHIDONIC_ACID
EPA CompToxDTXCID80809735
Spectral data for Arachidonic acid standards
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Arachidonic acid

Rxn IDKEGG ReactionEnzyme
R01317 Phosphatidylcholine + H2O <=> 1-Acyl-sn-glycero-3-phosphocholine + Arachidonatephosphatidylcholine 2-acylhydrolase
R01590 Arachidonate + 2 Oxygen <=> Prostaglandin G2Arachidonate:oxygen oxidoreductase
R01593 Arachidonate + Oxygen <=> 15(S)-HPETEarachidonate:oxygen 15-oxidoreductase
R01595 Arachidonate + Oxygen <=> 5(S)-HPETEArachidonate:oxygen 5-oxidoreductase
R01596 Arachidonate + Oxygen <=> 12(S)-HPETEarachidonate:oxygen 12-oxidoreductase
R07038 Arachidonate + Oxygen <=> 12(R)-HPETEArachidonate: oxygen 12-oxidoreductase
R07041 Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 20-HETE + [Oxidized NADPH---hemoprotein reductase] + H2OArachidonic acid:oxygen 1-oxidoreductase
R07046 Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19(S)-HETE + [Oxidized NADPH---hemoprotein reductase] + H2OArachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19(S)-HETE + [Oxidized NADPH---hemoprotein reductase] + H2O
R07048 Arachidonate + Oxygen + NADPH + H+ <=> 14,15-EET + NADP+ + H2OArachidonate + Oxygen + NADPH + H+ <=> 14,15-EET + NADP+ + H2O
R07050 Arachidonate + Oxygen + NADPH + H+ <=> 11,12-EET + NADP+ + H2OArachidonate + Oxygen + NADPH + H+ <=> 11,12-EET + NADP+ + H2O
R07051 Arachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2OArachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2O
R07052 Arachidonate + Oxygen + NADPH + H+ <=> 5,6-EET + NADP+ + H2OArachidonate + Oxygen + NADPH + H+ <=> 5,6-EET + NADP+ + H2O
R07053 Arachidonate + Oxygen <=> 8(S)-HPETEArachidonate:oxygen 8-oxidoreductase
R08183 Arachidonyl-CoA + H2O <=> CoA + ArachidonateArachidonyl-CoA + H2O <=> CoA + Arachidonate

Table of KEGG human pathways containing Arachidonic acid

Pathway IDHuman Pathway# of reactions
hsa00590 Arachidonic acid metabolism 13
hsa01040 Biosynthesis of unsaturated fatty acids 1
  logo