RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet ID	RM0153612
RefMet name	Arachidonic acid
Alternative name	FA 20:4(5Z,8Z,11Z,14Z)
Systematic name	5Z,8Z,11Z,14Z-eicosatetraenoic acid
Synonyms	PubChem Synonyms
Sum Composition	FA 20:4	View other entries in RefMet with this sum composition
Exact mass	304.240230 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C20H32O2	View other entries in RefMet with this formula
Molecular descriptors
Molfile	436 (Download molfile/View MW Metabolite Database details)
InChI	InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,2 2)/b7-6-,10-9-,13-12-,16-15-
InChIKey	YZXBAPSDXZZRGB-DOFZRALJSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
SMILES	CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super Class	Fatty Acyls
Main Class	Fatty acids
Sub Class	Unsaturated FA
Distribution of Arachidonic acid in NMDR studies
Species	Plot Species distribution
Sample source	Plot Sample source(tissue) distribution
Platform	Platform (MS/NMR) used for detection
Chromatography	Chromatography methods used for detection
Studies	NMDR Studies reporting Arachidonic acid
External Links
Pubchem CID	444899
LIPID MAPS	LMFA01030001
ChEBI ID	15843
KEGG ID	C00219
HMDB ID	HMDB0001043
Chemspider ID	392692
MetaCyc ID	ARACHIDONIC_ACID
EPA CompTox	DTXCID80809735
Spectral data for Arachidonic acid standards
MassBank(EU)	View MS spectra
Structural annotation level
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Arachidonic acid

Rxn ID	KEGG Reaction	Enzyme
R01317	Phosphatidylcholine + H2O <=> 1-Acyl-sn-glycero-3-phosphocholine + Arachidonate	phosphatidylcholine 2-acylhydrolase
R01590	Arachidonate + 2 Oxygen <=> Prostaglandin G2	Arachidonate:oxygen oxidoreductase
R01593	Arachidonate + Oxygen <=> 15(S)-HPETE	arachidonate:oxygen 15-oxidoreductase
R01595	Arachidonate + Oxygen <=> 5(S)-HPETE	Arachidonate:oxygen 5-oxidoreductase
R01596	Arachidonate + Oxygen <=> 12(S)-HPETE	arachidonate:oxygen 12-oxidoreductase
R07038	Arachidonate + Oxygen <=> 12(R)-HPETE	Arachidonate: oxygen 12-oxidoreductase
R07041	Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 20-HETE + [Oxidized NADPH---hemoprotein reductase] + H2O	Arachidonic acid:oxygen 1-oxidoreductase
R07046	Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19(S)-HETE + [Oxidized NADPH---hemoprotein reductase] + H2O	Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19(S)-HETE + [Oxidized NADPH---hemoprotein reductase] + H2O
R07048	Arachidonate + Oxygen + NADPH + H+ <=> 14,15-EET + NADP+ + H2O	Arachidonate + Oxygen + NADPH + H+ <=> 14,15-EET + NADP+ + H2O
R07050	Arachidonate + Oxygen + NADPH + H+ <=> 11,12-EET + NADP+ + H2O	Arachidonate + Oxygen + NADPH + H+ <=> 11,12-EET + NADP+ + H2O
R07051	Arachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2O	Arachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2O
R07052	Arachidonate + Oxygen + NADPH + H+ <=> 5,6-EET + NADP+ + H2O	Arachidonate + Oxygen + NADPH + H+ <=> 5,6-EET + NADP+ + H2O
R07053	Arachidonate + Oxygen <=> 8(S)-HPETE	Arachidonate:oxygen 8-oxidoreductase
R08183	Arachidonyl-CoA + H2O <=> CoA + Arachidonate	Arachidonyl-CoA + H2O <=> CoA + Arachidonate

Table of KEGG human pathways containing Arachidonic acid

Pathway ID	Human Pathway	# of reactions
hsa00590	Arachidonic acid metabolism	13
hsa01040	Biosynthesis of unsaturated fatty acids	1